C13H17N5O2 — CID 136904589
4-[3-(4-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]benzene-1,2-diol (PubChem CID 136904589) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[3-(4-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]benzene-1,2-diol.
| Compound Name | 4-[3-(4-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136904589 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 4-[3-(4-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]benzene-1,2-diol |
| SMILES | NC1CCN(c2n[nH]c(-c3ccc(O)c(O)c3)n2)CC1 |
| InChI | InChI=1S/C13H17N5O2/c14-9-3-5-18(6-4-9)13-15-12(16-17-13)8-1-2-10(19)11(20)7-8/h1-2,7,9,19-20H,3-6,14H2,(H,15,16,17) |
| InChIKey | RJZFYCBUDBLYGG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|