C19H27N5 — CID 136905515
1-[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]methanamine (PubChem CID 136905515) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]methanamine.
| Compound Name | 1-[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 136905515 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 1-[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]methanamine |
| SMILES | Cc1cc2n(n1)C[C@@H](CNCc1ccc(N3CCCC3)cc1)CN2 |
| InChI | InChI=1S/C19H27N5/c1-15-10-19-21-13-17(14-24(19)22-15)12-20-11-16-4-6-18(7-5-16)23-8-2-3-9-23/h4-7,10,17,20-21H,2-3,8-9,11-14H2,1H3/t17-/m0/s1 |
| InChIKey | MHBURQYEQKZGLP-KRWDZBQOSA-N |
| XLogP | 2.62 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|