C20H19ClN4O5 — CID 136908108
N-[(Z)-(5-chloro-2-oxo-3-phenyl-1H-imidazol-4-yl)methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 136908108) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-2-oxo-3-phenyl-1H-imidazol-4-yl)methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-(5-chloro-2-oxo-3-phenyl-1H-imidazol-4-yl)methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 136908108 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | N-[(Z)-(5-chloro-2-oxo-3-phenyl-1H-imidazol-4-yl)methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C\c2c(Cl)[nH]c(=O)n2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19ClN4O5/c1-28-15-9-12(10-16(29-2)17(15)30-3)19(26)24-22-11-14-18(21)23-20(27)25(14)13-7-5-4-6-8-13/h4-11H,1-3H3,(H,23,27)(H,24,26)/b22-11- |
| InChIKey | VBGINNAKHGQRCC-JJFYIABZSA-N |
| XLogP | 2.61 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|