C27H25NO — CID 136908222
2-(5-benzyl-6-methyl-3-phenyl-2-pyridinyl)-3,5-dimethylphenol (PubChem CID 136908222) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(5-benzyl-6-methyl-3-phenyl-2-pyridinyl)-3,5-dimethylphenol.
| Compound Name | 2-(5-benzyl-6-methyl-3-phenyl-2-pyridinyl)-3,5-dimethylphenol |
|---|---|
| PubChem CID | 136908222 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-(5-benzyl-6-methyl-3-phenyl-2-pyridinyl)-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(-c2nc(C)c(Cc3ccccc3)cc2-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C27H25NO/c1-18-14-19(2)26(25(29)15-18)27-24(22-12-8-5-9-13-22)17-23(20(3)28-27)16-21-10-6-4-7-11-21/h4-15,17,29H,16H2,1-3H3 |
| InChIKey | UWJJRSIIGPMOGY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |