About 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one
2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one (PubChem CID 136908250) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 136908250 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCC/N=C1\Cn2c(nc(C)cc2=O)N1 |
| InChI | InChI=1S/C11H16N4O/c1-3-4-5-12-9-7-15-10(16)6-8(2)13-11(15)14-9/h6H,3-5,7H2,1-2H3,(H,12,13,14) |
| InChIKey | CTWWEIYUGSONSP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one (CID 136908250) is 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one is CCCC/N=C1\Cn2c(nc(C)cc2=O)N1.
What is the InChIKey of 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one?
The InChIKey is CTWWEIYUGSONSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-3-4-5-12-9-7-15-10(16)6-8(2)13-11(15)14-9/h6H,3-5,7H2,1-2H3,(H,12,13,14).
What are the key properties of 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one?
2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one has a molecular weight of 220.28 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylimino-7-methyl-1,3-dihydroimidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 136908250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).