C16H15F2N3O2S — CID 136910125
(5S)-5-(2,3-difluorophenyl)-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136910125) has the molecular formula C16H15F2N3O2S and a molecular weight of 351.38 g/mol. Its IUPAC name is (5S)-5-(2,3-difluorophenyl)-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-5-(2,3-difluorophenyl)-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136910125 |
| Molecular Formula | C16H15F2N3O2S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (5S)-5-(2,3-difluorophenyl)-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCSc1nc2c(c(=O)[nH]1)[C@@H](c1cccc(F)c1F)CC(=O)N2 |
| InChI | InChI=1S/C16H15F2N3O2S/c1-2-6-24-16-20-14-12(15(23)21-16)9(7-11(22)19-14)8-4-3-5-10(17)13(8)18/h3-5,9H,2,6-7H2,1H3,(H2,19,20,21,22,23)/t9-/m1/s1 |
| InChIKey | YIWIOVVAUUKHAJ-SECBINFHSA-N |
| XLogP | 3.02 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |