C16H12Cl2N4O — CID 136910636
2,4-dichloro-6-[(Z)-[(Z)-[(3R)-3-phenyl-3,4-dihydropyrazol-5-ylidene]hydrazinylidene]methyl]phenol (PubChem CID 136910636) has the molecular formula C16H12Cl2N4O and a molecular weight of 347.21 g/mol. Its IUPAC name is 2,4-dichloro-6-[(Z)-[(Z)-[(3R)-3-phenyl-3,4-dihydropyrazol-5-ylidene]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(Z)-[(Z)-[(3R)-3-phenyl-3,4-dihydropyrazol-5-ylidene]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136910636 |
| Molecular Formula | C16H12Cl2N4O |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2,4-dichloro-6-[(Z)-[(Z)-[(3R)-3-phenyl-3,4-dihydropyrazol-5-ylidene]hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N\N=C1\C[C@H](c2ccccc2)N=N1 |
| InChI | InChI=1S/C16H12Cl2N4O/c17-12-6-11(16(23)13(18)7-12)9-19-21-15-8-14(20-22-15)10-4-2-1-3-5-10/h1-7,9,14,23H,8H2/b19-9-,21-15-/t14-/m1/s1 |
| InChIKey | SSLZZBFLKKIIFH-BASIOVDCSA-N |
| XLogP | 5.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|