About propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate
propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate (PubChem CID 136911011) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate.
Molecular Properties
| Compound Name | propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate |
| PubChem CID | 136911011 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate |
| SMILES | Cc1cc(O)c(C(=O)OC(C)C)c(C)c1/N=N/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-13(2)27-21(26)19-15(4)20(14(3)12-18(19)25)24-23-17-10-8-16(9-11-17)22(5,6)7/h8-13,25H,1-7H3/b24-23+ |
| InChIKey | QXMXMOWWMBGLEC-WCWDXBQESA-N |
| XLogP | 6.29 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate?
The IUPAC name of propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate (CID 136911011) is propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate.
What is the SMILES notation for propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate?
The canonical SMILES for propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate is Cc1cc(O)c(C(=O)OC(C)C)c(C)c1/N=N/c1ccc(C(C)(C)C)cc1.
What is the InChIKey of propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate?
The InChIKey is QXMXMOWWMBGLEC-WCWDXBQESA-N. The full InChI is InChI=1S/C22H28N2O3/c1-13(2)27-21(26)19-15(4)20(14(3)12-18(19)25)24-23-17-10-8-16(9-11-17)22(5,6)7/h8-13,25H,1-7H3/b24-23+.
What are the key properties of propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate?
propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate has a molecular weight of 368.48 g/mol, XLogP of 6.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-[(4-tert-butylphenyl)diazenyl]-6-hydroxy-2,4-dimethylbenzoate is sourced from PubChem (CID 136911011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).