C24H21N3O — CID 136911485
(5E)-5-benzylidene-2-benzylimino-3-(4-methylphenyl)imidazolidin-4-one (PubChem CID 136911485) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is (5E)-5-benzylidene-2-benzylimino-3-(4-methylphenyl)imidazolidin-4-one.
| Compound Name | (5E)-5-benzylidene-2-benzylimino-3-(4-methylphenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 136911485 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (5E)-5-benzylidene-2-benzylimino-3-(4-methylphenyl)imidazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccccc3)N/C2=N\Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-18-12-14-21(15-13-18)27-23(28)22(16-19-8-4-2-5-9-19)26-24(27)25-17-20-10-6-3-7-11-20/h2-16H,17H2,1H3,(H,25,26)/b22-16+ |
| InChIKey | OPAHQQYJQITITF-CJLVFECKSA-N |
| XLogP | 4.53 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|