C20H18N4O3 — CID 136911857
4-methyl-N-[2-oxo-2-[(2Z)-2-[(2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 136911857) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-methyl-N-[2-oxo-2-[(2Z)-2-[(2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-methyl-N-[2-oxo-2-[(2Z)-2-[(2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 136911857 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-methyl-N-[2-oxo-2-[(2Z)-2-[(2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N/N=C\c2cc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H18N4O3/c1-13-6-8-14(9-7-13)19(26)21-12-18(25)24-22-11-16-10-15-4-2-3-5-17(15)23-20(16)27/h2-11H,12H2,1H3,(H,21,26)(H,23,27)(H,24,25)/b22-11- |
| InChIKey | KBUDPCHQWYVHMD-JJFYIABZSA-N |
| XLogP | 1.72 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|