C16H17N5O2S — CID 136911948
(2S)-N-(3-methylphenyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]butanamide (PubChem CID 136911948) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is (2S)-N-(3-methylphenyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]butanamide.
| Compound Name | (2S)-N-(3-methylphenyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 136911948 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2S)-N-(3-methylphenyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]butanamide |
| SMILES | CC[C@H](Sc1nc2nc[nH]c2c(=O)[nH]1)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C16H17N5O2S/c1-3-11(14(22)19-10-6-4-5-9(2)7-10)24-16-20-13-12(15(23)21-16)17-8-18-13/h4-8,11H,3H2,1-2H3,(H,19,22)(H2,17,18,20,21,23)/t11-/m0/s1 |
| InChIKey | KNXYDUQTMDDBTB-NSHDSACASA-N |
| XLogP | 2.46 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |