C32H21N3O5 — CID 136912096
4-[(9,10-dioxoanthracen-1-yl)diazenyl]-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 136912096) has the molecular formula C32H21N3O5 and a molecular weight of 527.54 g/mol. Its IUPAC name is 4-[(9,10-dioxoanthracen-1-yl)diazenyl]-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[(9,10-dioxoanthracen-1-yl)diazenyl]-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 136912096 |
| Molecular Formula | C32H21N3O5 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 4-[(9,10-dioxoanthracen-1-yl)diazenyl]-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3c(/N=N/c3cccc4c3C(=O)c3ccccc3C4=O)c2O)cc1 |
| InChI | InChI=1S/C32H21N3O5/c1-40-20-15-13-19(14-16-20)33-32(39)25-17-18-7-2-3-8-21(18)28(31(25)38)35-34-26-12-6-11-24-27(26)30(37)23-10-5-4-9-22(23)29(24)36/h2-17,38H,1H3,(H,33,39)/b35-34+ |
| InChIKey | WRSVKBHDJCVSSF-XAHDOWKMSA-N |
| XLogP | 7.00 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|