About 3-methylidenecyclohexa-1,4-diene-1-carbonitrile
3-methylidenecyclohexa-1,4-diene-1-carbonitrile (PubChem CID 136913955) has the molecular formula C8H6N+
and a molecular weight of 116.14 g/mol. Its IUPAC name is 3-methylidenecyclohexa-1,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 3-methylidenecyclohexa-1,4-diene-1-carbonitrile |
| PubChem CID | 136913955 |
| Molecular Formula | C8H6N+ |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 3-methylidenecyclohexa-1,4-diene-1-carbonitrile |
| SMILES | [H]/[C+]=C1\C=CCC(C#N)=C1 |
| InChI | InChI=1S/C8H6N/c1-7-3-2-4-8(5-7)6-9/h1-3,5H,4H2/q+1 |
| InChIKey | RGUSEZHXQGUNBA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenecyclohexa-1,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenecyclohexa-1,4-diene-1-carbonitrile?
The IUPAC name of 3-methylidenecyclohexa-1,4-diene-1-carbonitrile (CID 136913955) is 3-methylidenecyclohexa-1,4-diene-1-carbonitrile.
What is the SMILES notation for 3-methylidenecyclohexa-1,4-diene-1-carbonitrile?
The canonical SMILES for 3-methylidenecyclohexa-1,4-diene-1-carbonitrile is [H]/[C+]=C1\C=CCC(C#N)=C1.
What is the InChIKey of 3-methylidenecyclohexa-1,4-diene-1-carbonitrile?
The InChIKey is RGUSEZHXQGUNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N/c1-7-3-2-4-8(5-7)6-9/h1-3,5H,4H2/q+1.
What are the key properties of 3-methylidenecyclohexa-1,4-diene-1-carbonitrile?
3-methylidenecyclohexa-1,4-diene-1-carbonitrile has a molecular weight of 116.14 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenecyclohexa-1,4-diene-1-carbonitrile is sourced from PubChem (CID 136913955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).