About 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol
5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol (PubChem CID 136914013) has the molecular formula C20H25NO3
and a molecular weight of 327.42 g/mol. Its IUPAC name is 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol.
Molecular Properties
| Compound Name | 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol |
| PubChem CID | 136914013 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol |
| SMILES | Cc1cc(-c2ccc(C3=C(C(C)(C)C)C(C)(C)CO3)cc2O)no1 |
| InChI | InChI=1S/C20H25NO3/c1-12-9-15(21-24-12)14-8-7-13(10-16(14)22)17-18(19(2,3)4)20(5,6)11-23-17/h7-10,22H,11H2,1-6H3 |
| InChIKey | FTBFCDKDBWZKQT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol?
The IUPAC name of 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol (CID 136914013) is 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol.
What is the SMILES notation for 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol?
The canonical SMILES for 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol is Cc1cc(-c2ccc(C3=C(C(C)(C)C)C(C)(C)CO3)cc2O)no1.
What is the InChIKey of 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol?
The InChIKey is FTBFCDKDBWZKQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3/c1-12-9-15(21-24-12)14-8-7-13(10-16(14)22)17-18(19(2,3)4)20(5,6)11-23-17/h7-10,22H,11H2,1-6H3.
What are the key properties of 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol?
5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol has a molecular weight of 327.42 g/mol, XLogP of 5.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)-2-(5-methyl-1,2-oxazol-3-yl)phenol is sourced from PubChem (CID 136914013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).