C10H17BrN4O — CID 136914206
5-bromo-4-[methyl-[2-methyl-3-(methylamino)propyl]amino]-1H-pyrimidin-6-one (PubChem CID 136914206) has the molecular formula C10H17BrN4O and a molecular weight of 289.18 g/mol. Its IUPAC name is 5-bromo-4-[methyl-[2-methyl-3-(methylamino)propyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[methyl-[2-methyl-3-(methylamino)propyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136914206 |
| Molecular Formula | C10H17BrN4O |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-bromo-4-[methyl-[2-methyl-3-(methylamino)propyl]amino]-1H-pyrimidin-6-one |
| SMILES | CNCC(C)CN(C)c1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H17BrN4O/c1-7(4-12-2)5-15(3)9-8(11)10(16)14-6-13-9/h6-7,12H,4-5H2,1-3H3,(H,13,14,16) |
| InChIKey | CAWOLBCTKBTXRW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |