About potassium 3-methyl-4H-1,2,4-oxadiazol-5-one
potassium 3-methyl-4H-1,2,4-oxadiazol-5-one (PubChem CID 136915235) has the molecular formula C3H4KN2O2+
and a molecular weight of 139.18 g/mol. Its IUPAC name is potassium 3-methyl-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | potassium 3-methyl-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 136915235 |
| Molecular Formula | C3H4KN2O2+ |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 138.99 |
| IUPAC Name | potassium 3-methyl-4H-1,2,4-oxadiazol-5-one |
| SMILES | Cc1noc(=O)[nH]1.[K+] |
| InChI | InChI=1S/C3H4N2O2.K/c1-2-4-3(6)7-5-2;/h1H3,(H,4,5,6);/q;+1 |
| InChIKey | ZTUAMBCLZXCQIK-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 3-methyl-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-methyl-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of potassium 3-methyl-4H-1,2,4-oxadiazol-5-one (CID 136915235) is potassium 3-methyl-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for potassium 3-methyl-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for potassium 3-methyl-4H-1,2,4-oxadiazol-5-one is Cc1noc(=O)[nH]1.[K+].
What is the InChIKey of potassium 3-methyl-4H-1,2,4-oxadiazol-5-one?
The InChIKey is ZTUAMBCLZXCQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.K/c1-2-4-3(6)7-5-2;/h1H3,(H,4,5,6);/q;+1.
What are the key properties of potassium 3-methyl-4H-1,2,4-oxadiazol-5-one?
potassium 3-methyl-4H-1,2,4-oxadiazol-5-one has a molecular weight of 139.18 g/mol, XLogP of -3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-methyl-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 136915235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).