C24H30N4O2 — CID 136916075
2-amino-6-[2-(cyclohexylmethoxy)-6-hydroxyphenyl]-4-piperidin-4-ylpyridine-3-carbonitrile (PubChem CID 136916075) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-amino-6-[2-(cyclohexylmethoxy)-6-hydroxyphenyl]-4-piperidin-4-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-[2-(cyclohexylmethoxy)-6-hydroxyphenyl]-4-piperidin-4-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136916075 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-amino-6-[2-(cyclohexylmethoxy)-6-hydroxyphenyl]-4-piperidin-4-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(C2CCNCC2)cc(-c2c(O)cccc2OCC2CCCCC2)nc1N |
| InChI | InChI=1S/C24H30N4O2/c25-14-19-18(17-9-11-27-12-10-17)13-20(28-24(19)26)23-21(29)7-4-8-22(23)30-15-16-5-2-1-3-6-16/h4,7-8,13,16-17,27,29H,1-3,5-6,9-12,15H2,(H2,26,28) |
| InChIKey | WYVPBSZHQIEJLU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |