C32H29N5O4 — CID 136916281
N-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)diazenyl]-6-phenylpyridazin-4-imine (PubChem CID 136916281) has the molecular formula C32H29N5O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)diazenyl]-6-phenylpyridazin-4-imine.
| Compound Name | N-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)diazenyl]-6-phenylpyridazin-4-imine |
|---|---|
| PubChem CID | 136916281 |
| Molecular Formula | C32H29N5O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)diazenyl]-6-phenylpyridazin-4-imine |
| SMILES | COc1ccc(/N=N/c2c(-c3ccccc3)n(-c3ccc(OC)cc3)nc/c2=N\c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C32H29N5O4/c1-38-25-14-10-23(11-15-25)35-36-31-29(34-28-19-18-27(40-3)20-30(28)41-4)21-33-37(24-12-16-26(39-2)17-13-24)32(31)22-8-6-5-7-9-22/h5-21H,1-4H3/b34-29+,36-35+ |
| InChIKey | JZSPQXJRAHDQBL-JCYGFXGOSA-N |
| XLogP | 7.22 |
| TPSA | 91.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|