C23H17ClF3NO4 — CID 136916347
ethyl 2-[2-[(3-chloro-2-hydroxyphenyl)methylideneamino]-4-(trifluoromethyl)phenoxy]benzoate (PubChem CID 136916347) has the molecular formula C23H17ClF3NO4 and a molecular weight of 463.84 g/mol. Its IUPAC name is ethyl 2-[2-[(3-chloro-2-hydroxyphenyl)methylideneamino]-4-(trifluoromethyl)phenoxy]benzoate.
| Compound Name | ethyl 2-[2-[(3-chloro-2-hydroxyphenyl)methylideneamino]-4-(trifluoromethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 136916347 |
| Molecular Formula | C23H17ClF3NO4 |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | ethyl 2-[2-[(3-chloro-2-hydroxyphenyl)methylideneamino]-4-(trifluoromethyl)phenoxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1Oc1ccc(C(F)(F)F)cc1/N=C/c1cccc(Cl)c1O |
| InChI | InChI=1S/C23H17ClF3NO4/c1-2-31-22(30)16-7-3-4-9-19(16)32-20-11-10-15(23(25,26)27)12-18(20)28-13-14-6-5-8-17(24)21(14)29/h3-13,29H,2H2,1H3/b28-13+ |
| InChIKey | JPHYTTNMKVVVOC-XODNFHPESA-N |
| XLogP | 6.78 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|