C9H12Cl2IN3O — CID 136918129
4-[[1-chloro-2-(chloromethyl)butan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136918129) has the molecular formula C9H12Cl2IN3O and a molecular weight of 376.03 g/mol. Its IUPAC name is 4-[[1-chloro-2-(chloromethyl)butan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[[1-chloro-2-(chloromethyl)butan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136918129 |
| Molecular Formula | C9H12Cl2IN3O |
| Molecular Weight | 376.03 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 4-[[1-chloro-2-(chloromethyl)butan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC(CCl)(CCl)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H12Cl2IN3O/c1-2-9(3-10,4-11)15-7-6(12)8(16)14-5-13-7/h5H,2-4H2,1H3,(H2,13,14,15,16) |
| InChIKey | VGSOIHPQCHMPDY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.03 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|