About 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine
3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 136918426) has the molecular formula C8H11N2+
and a molecular weight of 135.19 g/mol. Its IUPAC name is 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 136918426 |
| Molecular Formula | C8H11N2+ |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C1\C=C(N(C)C)C=C[CH+]1 |
| InChI | InChI=1S/C8H11N2/c1-10(2)8-5-3-4-7(9)6-8/h3-6,9H,1-2H3/q+1/b9-7- |
| InChIKey | DRQGFFVIIZYNEG-CLFYSBASSA-N |
| XLogP | 1.23 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine (CID 136918426) is 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine is [H]/N=C1\C=C(N(C)C)C=C[CH+]1.
What is the InChIKey of 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine?
The InChIKey is DRQGFFVIIZYNEG-CLFYSBASSA-N. The full InChI is InChI=1S/C8H11N2/c1-10(2)8-5-3-4-7(9)6-8/h3-6,9H,1-2H3/q+1/b9-7-.
What are the key properties of 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine?
3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine has a molecular weight of 135.19 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-N,N-dimethylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 136918426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).