C60H46N4O8 — CID 136918531
[4-[10,15,20-tris[4-(2-methylprop-2-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 136918531) has the molecular formula C60H46N4O8 and a molecular weight of 951.05 g/mol. Its IUPAC name is [4-[10,15,20-tris[4-(2-methylprop-2-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[10,15,20-tris[4-(2-methylprop-2-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 136918531 |
| Molecular Formula | C60H46N4O8 |
| Molecular Weight | 951.05 g/mol |
| Exact Mass | 950.33 |
| IUPAC Name | [4-[10,15,20-tris[4-(2-methylprop-2-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2c3nc(c(-c4ccc(OC(=O)C(=C)C)cc4)c4ccc([nH]4)c(-c4ccc(OC(=O)C(=C)C)cc4)c4nc(c(-c5ccc(OC(=O)C(=C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C60H46N4O8/c1-33(2)57(65)69-41-17-9-37(10-18-41)53-45-25-27-47(61-45)54(38-11-19-42(20-12-38)70-58(66)34(3)4)49-29-31-51(63-49)56(40-15-23-44(24-16-40)72-60(68)36(7)8)52-32-30-50(64-52)55(48-28-26-46(53)62-48)39-13-21-43(22-14-39)71-59(67)35(5)6/h9-32,61,64H,1,3,5,7H2,2,4,6,8H3/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51-,56-52- |
| InChIKey | ALRJSJSKAWQVNK-YFLSTINXSA-N |
| XLogP | 13.25 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.05 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|