C21H22BrN5 — CID 1369192
N-[(2-bromophenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine (PubChem CID 1369192) has the molecular formula C21H22BrN5 and a molecular weight of 424.35 g/mol. Its IUPAC name is N-[(2-bromophenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine.
| Compound Name | N-[(2-bromophenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
|---|---|
| PubChem CID | 1369192 |
| Molecular Formula | C21H22BrN5 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[(2-bromophenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
| SMILES | Brc1ccccc1C=NN=C(c1ccccc1)C12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C21H22BrN5/c22-19-9-5-4-8-18(19)10-23-24-20(17-6-2-1-3-7-17)21-11-25-14-26(12-21)16-27(13-21)15-25/h1-10H,11-16H2 |
| InChIKey | JNNBJMFWMSZZBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|