C12H12N4O3S — CID 136919468
ethyl 6-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylate (PubChem CID 136919468) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is ethyl 6-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 136919468 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | ethyl 6-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Sc2nc(N)cc(=O)[nH]2)nc1 |
| InChI | InChI=1S/C12H12N4O3S/c1-2-19-11(18)7-3-4-10(14-6-7)20-12-15-8(13)5-9(17)16-12/h3-6H,2H2,1H3,(H3,13,15,16,17) |
| InChIKey | MTDCCLDWQIWNEB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |