C15H17BrClN3O — CID 136920385
2-(3-bromo-4-chlorophenyl)-4-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one (PubChem CID 136920385) has the molecular formula C15H17BrClN3O and a molecular weight of 370.68 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-4-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-4-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136920385 |
| Molecular Formula | C15H17BrClN3O |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-4-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)CNCc1cc(=O)[nH]c(-c2ccc(Cl)c(Br)c2)n1 |
| InChI | InChI=1S/C15H17BrClN3O/c1-9(2)7-18-8-11-6-14(21)20-15(19-11)10-3-4-13(17)12(16)5-10/h3-6,9,18H,7-8H2,1-2H3,(H,19,20,21) |
| InChIKey | RCGBFSKKONJGAE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |