C11H11N3O2 — CID 136920498
2-(oxolan-2-yl)-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 136920498) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(oxolan-2-yl)-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136920498 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-(oxolan-2-yl)-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CCCO2)nc2cnccc12 |
| InChI | InChI=1S/C11H11N3O2/c15-11-7-3-4-12-6-8(7)13-10(14-11)9-2-1-5-16-9/h3-4,6,9H,1-2,5H2,(H,13,14,15) |
| InChIKey | BVIMDTLSDVRSCL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |