C22H30IN5O3 — CID 136920718
1-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 136920718) has the molecular formula C22H30IN5O3 and a molecular weight of 539.42 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136920718 |
| Molecular Formula | C22H30IN5O3 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 1-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCOCC1)NCc1ccccc1[N+](=O)[O-].I |
| InChI | InChI=1S/C22H29N5O3.HI/c1-2-23-22(25-16-19-8-5-6-10-21(19)27(28)29)24-15-18-7-3-4-9-20(18)17-26-11-13-30-14-12-26;/h3-10H,2,11-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | ANQISLCTKUHVND-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|