About 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline
7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline (PubChem CID 136921468) has the molecular formula C12H9ClN2
and a molecular weight of 216.67 g/mol. Its IUPAC name is 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline.
Molecular Properties
| Compound Name | 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline |
| PubChem CID | 136921468 |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline |
| SMILES | Cc1cc(Cl)[nH]c2ccc3nccc3c12 |
| InChI | InChI=1S/C12H9ClN2/c1-7-6-11(13)15-10-3-2-9-8(12(7)10)4-5-14-9/h2-6,15H,1H3 |
| InChIKey | NOMYOLCEGDDVIT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline?
The IUPAC name of 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline (CID 136921468) is 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline.
What is the SMILES notation for 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline?
The canonical SMILES for 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline is Cc1cc(Cl)[nH]c2ccc3nccc3c12.
What is the InChIKey of 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline?
The InChIKey is NOMYOLCEGDDVIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClN2/c1-7-6-11(13)15-10-3-2-9-8(12(7)10)4-5-14-9/h2-6,15H,1H3.
What are the key properties of 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline?
7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline has a molecular weight of 216.67 g/mol, XLogP of 3.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-9-methyl-6H-pyrrolo[3,2-f]quinoline is sourced from PubChem (CID 136921468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).