C13H12N4O5S — CID 136921629
2-[[6-[(4-methyl-2-nitrophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetic acid (PubChem CID 136921629) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is 2-[[6-[(4-methyl-2-nitrophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[6-[(4-methyl-2-nitrophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 136921629 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[[6-[(4-methyl-2-nitrophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetic acid |
| SMILES | Cc1ccc(Cc2nnc(SCC(=O)O)[nH]c2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N4O5S/c1-7-2-3-8(10(4-7)17(21)22)5-9-12(20)14-13(16-15-9)23-6-11(18)19/h2-4H,5-6H2,1H3,(H,18,19)(H,14,16,20) |
| InChIKey | BVHSIKFHRWOPMT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|