C15H21N3O — CID 136921987
1-ethyl-2-[2-(2-methylphenoxy)ethyl]-3-prop-2-ynylguanidine (PubChem CID 136921987) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methylphenoxy)ethyl]-3-prop-2-ynylguanidine.
| Compound Name | 1-ethyl-2-[2-(2-methylphenoxy)ethyl]-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 136921987 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-ethyl-2-[2-(2-methylphenoxy)ethyl]-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CCOc1ccccc1C)NCC |
| InChI | InChI=1S/C15H21N3O/c1-4-10-17-15(16-5-2)18-11-12-19-14-9-7-6-8-13(14)3/h1,6-9H,5,10-12H2,2-3H3,(H2,16,17,18) |
| InChIKey | VBDXSBUFHKHVHM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|