About 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine
1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine (PubChem CID 136922716) has the molecular formula C11H12N6
and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine |
| PubChem CID | 136922716 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine |
| SMILES | Cc1[nH]ncc1-c1nn(C)c2ncc(N)cc12 |
| InChI | InChI=1S/C11H12N6/c1-6-9(5-14-15-6)10-8-3-7(12)4-13-11(8)17(2)16-10/h3-5H,12H2,1-2H3,(H,14,15) |
| InChIKey | XMKDUYJFLCHXJO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine?
The IUPAC name of 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine (CID 136922716) is 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine.
What is the SMILES notation for 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine?
The canonical SMILES for 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine is Cc1[nH]ncc1-c1nn(C)c2ncc(N)cc12.
What is the InChIKey of 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine?
The InChIKey is XMKDUYJFLCHXJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N6/c1-6-9(5-14-15-6)10-8-3-7(12)4-13-11(8)17(2)16-10/h3-5H,12H2,1-2H3,(H,14,15).
What are the key properties of 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine?
1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine has a molecular weight of 228.26 g/mol, XLogP of 1.25, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(5-methyl-1H-pyrazol-4-yl)pyrazolo[5,4-b]pyridin-5-amine is sourced from PubChem (CID 136922716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).