C11H10N2O — CID 136922770
7-methyl-4,5-dihydro-[1,2]oxazolo[4,5-c]quinoline (PubChem CID 136922770) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-methyl-4,5-dihydro-[1,2]oxazolo[4,5-c]quinoline.
| Compound Name | 7-methyl-4,5-dihydro-[1,2]oxazolo[4,5-c]quinoline |
|---|---|
| PubChem CID | 136922770 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 7-methyl-4,5-dihydro-[1,2]oxazolo[4,5-c]quinoline |
| SMILES | Cc1ccc2c(c1)NCc1cnoc1-2 |
| InChI | InChI=1S/C11H10N2O/c1-7-2-3-9-10(4-7)12-5-8-6-13-14-11(8)9/h2-4,6,12H,5H2,1H3 |
| InChIKey | UPCOILVNARQOHW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |