C25H24N2O6 — CID 1369230
3,5-bis[(4-ethoxybenzoyl)amino]benzoic acid (PubChem CID 1369230) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 3,5-bis[(4-ethoxybenzoyl)amino]benzoic acid.
| Compound Name | 3,5-bis[(4-ethoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 1369230 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3,5-bis[(4-ethoxybenzoyl)amino]benzoic acid |
| SMILES | CCOc1ccc(C(=O)Nc2cc(NC(=O)c3ccc(OCC)cc3)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H24N2O6/c1-3-32-21-9-5-16(6-10-21)23(28)26-19-13-18(25(30)31)14-20(15-19)27-24(29)17-7-11-22(12-8-17)33-4-2/h5-15H,3-4H2,1-2H3,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | GOLUMAZCUCLRDX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |