About 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one
7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 136923867) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 136923867 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | Nc1cc(=O)n2c(n1)NCC2 |
| InChI | InChI=1S/C6H8N4O/c7-4-3-5(11)10-2-1-8-6(10)9-4/h3H,1-2,7H2,(H,8,9) |
| InChIKey | VJJMZRVJUINTCQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one (CID 136923867) is 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one is Nc1cc(=O)n2c(n1)NCC2.
What is the InChIKey of 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one?
The InChIKey is VJJMZRVJUINTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c7-4-3-5(11)10-2-1-8-6(10)9-4/h3H,1-2,7H2,(H,8,9).
What are the key properties of 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one?
7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one has a molecular weight of 152.16 g/mol, XLogP of -0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2,3-dihydro-1H-imidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 136923867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).