C7H10N4 — CID 136923931
6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-imine (PubChem CID 136923931) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-imine.
| Compound Name | 6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-imine |
|---|---|
| PubChem CID | 136923931 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-imine |
| SMILES | [H]/N=c1\ccnc2n1CCCN2 |
| InChI | InChI=1S/C7H10N4/c8-6-2-4-10-7-9-3-1-5-11(6)7/h2,4,8H,1,3,5H2,(H,9,10)/b8-6+ |
| InChIKey | LXILQMFOMMLALQ-SOFGYWHQSA-N |
| XLogP | 0.18 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |