C13H18N4O3S — CID 136924361
N-[2-[(6,8-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]ethyl]acetamide (PubChem CID 136924361) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[2-[(6,8-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]ethyl]acetamide.
| Compound Name | N-[2-[(6,8-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 136924361 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[2-[(6,8-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]ethyl]acetamide |
| SMILES | CC(=O)NCC/N=C1\Nc2cc(C)cc(C)c2S(=O)(=O)N1 |
| InChI | InChI=1S/C13H18N4O3S/c1-8-6-9(2)12-11(7-8)16-13(17-21(12,19)20)15-5-4-14-10(3)18/h6-7H,4-5H2,1-3H3,(H,14,18)(H2,15,16,17) |
| InChIKey | RAABKJMNWMFCPZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|