C14H22N4O2S — CID 136924411
N,N-dimethyl-1,1-dioxo-3-pentylimino-4H-1λ6,2,4-benzothiadiazin-7-amine (PubChem CID 136924411) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is N,N-dimethyl-1,1-dioxo-3-pentylimino-4H-1λ6,2,4-benzothiadiazin-7-amine.
| Compound Name | N,N-dimethyl-1,1-dioxo-3-pentylimino-4H-1λ6,2,4-benzothiadiazin-7-amine |
|---|---|
| PubChem CID | 136924411 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N,N-dimethyl-1,1-dioxo-3-pentylimino-4H-1λ6,2,4-benzothiadiazin-7-amine |
| SMILES | CCCCC/N=C1\Nc2ccc(N(C)C)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C14H22N4O2S/c1-4-5-6-9-15-14-16-12-8-7-11(18(2)3)10-13(12)21(19,20)17-14/h7-8,10H,4-6,9H2,1-3H3,(H2,15,16,17) |
| InChIKey | SKSBLIFWBUMXAU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|