C11H19N5O3 — CID 136924679
3-[bis(2-hydroxyethyl)amino]-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 136924679) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)amino]-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-[bis(2-hydroxyethyl)amino]-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 136924679 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[bis(2-hydroxyethyl)amino]-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | Cc1nnc(N(CCO)CCO)c(/C(N)=N/O)c1C |
| InChI | InChI=1S/C11H19N5O3/c1-7-8(2)13-14-11(9(7)10(12)15-19)16(3-5-17)4-6-18/h17-19H,3-6H2,1-2H3,(H2,12,15) |
| InChIKey | RMDJRMPGEINYHX-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|