C13H24N4O — CID 136925187
2-(6-aminohexylamino)-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136925187) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(6-aminohexylamino)-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-(6-aminohexylamino)-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136925187 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-(6-aminohexylamino)-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1cc(=O)[nH]c(NCCCCCCN)n1 |
| InChI | InChI=1S/C13H24N4O/c1-10(2)11-9-12(18)17-13(16-11)15-8-6-4-3-5-7-14/h9-10H,3-8,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | VCLFVLZTWWZPHD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|