C16H25IN4O — CID 136925803
N-[3-[[ethylamino-(prop-2-enylamino)methylidene]amino]propyl]benzamide;hydroiodide (PubChem CID 136925803) has the molecular formula C16H25IN4O and a molecular weight of 416.31 g/mol. Its IUPAC name is N-[3-[[ethylamino-(prop-2-enylamino)methylidene]amino]propyl]benzamide;hydroiodide.
| Compound Name | N-[3-[[ethylamino-(prop-2-enylamino)methylidene]amino]propyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 136925803 |
| Molecular Formula | C16H25IN4O |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[3-[[ethylamino-(prop-2-enylamino)methylidene]amino]propyl]benzamide;hydroiodide |
| SMILES | C=CCN/C(=N/CCCNC(=O)c1ccccc1)NCC.I |
| InChI | InChI=1S/C16H24N4O.HI/c1-3-11-19-16(17-4-2)20-13-8-12-18-15(21)14-9-6-5-7-10-14;/h3,5-7,9-10H,1,4,8,11-13H2,2H3,(H,18,21)(H2,17,19,20);1H |
| InChIKey | NIXQKZPTOQJZQZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|