About 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide
1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 136926180) has the molecular formula C9H17F3IN3
and a molecular weight of 351.15 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| PubChem CID | 136926180 |
| Molecular Formula | C9H17F3IN3 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(=N/CCC(F)(F)F)NCC.I |
| InChI | InChI=1S/C9H16F3N3.HI/c1-3-6-14-8(13-4-2)15-7-5-9(10,11)12;/h3H,1,4-7H2,2H3,(H2,13,14,15);1H |
| InChIKey | BALPTACWKGIAJK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide?
The IUPAC name of 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (CID 136926180) is 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
What is the SMILES notation for 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide?
The canonical SMILES for 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide is C=CCN/C(=N/CCC(F)(F)F)NCC.I.
What is the InChIKey of 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide?
The InChIKey is BALPTACWKGIAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N3.HI/c1-3-6-14-8(13-4-2)15-7-5-9(10,11)12;/h3H,1,4-7H2,2H3,(H2,13,14,15);1H.
What are the key properties of 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide?
1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide has a molecular weight of 351.15 g/mol, XLogP of 2.30, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-prop-2-enyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide is sourced from PubChem (CID 136926180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).