About 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid
5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 136927079) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 136927079 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Nc1onc(-c2ncc[nH]2)c1C(=O)O |
| InChI | InChI=1S/C7H6N4O3/c8-5-3(7(12)13)4(11-14-5)6-9-1-2-10-6/h1-2H,8H2,(H,9,10)(H,12,13) |
| InChIKey | NGZOBIQJBAOWIN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid (CID 136927079) is 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid is Nc1onc(-c2ncc[nH]2)c1C(=O)O.
What is the InChIKey of 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid?
The InChIKey is NGZOBIQJBAOWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c8-5-3(7(12)13)4(11-14-5)6-9-1-2-10-6/h1-2H,8H2,(H,9,10)(H,12,13).
What are the key properties of 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid?
5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid has a molecular weight of 194.15 g/mol, XLogP of 0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(1H-imidazol-2-yl)-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 136927079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).