C25H22FN5O2 — CID 136928092
7-(2-aminophenyl)-2-[4-(4-fluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136928092) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is 7-(2-aminophenyl)-2-[4-(4-fluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 7-(2-aminophenyl)-2-[4-(4-fluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136928092 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 7-(2-aminophenyl)-2-[4-(4-fluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccc(F)cc3)cc2)nn2c1NCCC2c1ccccc1N |
| InChI | InChI=1S/C25H22FN5O2/c26-16-7-11-18(12-8-16)33-17-9-5-15(6-10-17)23-22(24(28)32)25-29-14-13-21(31(25)30-23)19-3-1-2-4-20(19)27/h1-12,21,29H,13-14,27H2,(H2,28,32) |
| InChIKey | ATVWSVZIBUCRNI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|