C24H21N5O2 — CID 136928118
8-amino-2-(4-phenoxyphenyl)-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]benzodiazepine-3-carboxamide (PubChem CID 136928118) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 8-amino-2-(4-phenoxyphenyl)-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]benzodiazepine-3-carboxamide.
| Compound Name | 8-amino-2-(4-phenoxyphenyl)-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 136928118 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 8-amino-2-(4-phenoxyphenyl)-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]benzodiazepine-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)nn2c1NCCc1cc(N)ccc1-2 |
| InChI | InChI=1S/C24H21N5O2/c25-17-8-11-20-16(14-17)12-13-27-24-21(23(26)30)22(28-29(20)24)15-6-9-19(10-7-15)31-18-4-2-1-3-5-18/h1-11,14,27H,12-13,25H2,(H2,26,30) |
| InChIKey | CBLHGBAZPIZWKP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|