C16H15FN2O2 — CID 136928272
3-(6-fluoro-1-propylbenzimidazol-2-yl)benzene-1,2-diol (PubChem CID 136928272) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-(6-fluoro-1-propylbenzimidazol-2-yl)benzene-1,2-diol.
| Compound Name | 3-(6-fluoro-1-propylbenzimidazol-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 136928272 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-(6-fluoro-1-propylbenzimidazol-2-yl)benzene-1,2-diol |
| SMILES | CCCn1c(-c2cccc(O)c2O)nc2ccc(F)cc21 |
| InChI | InChI=1S/C16H15FN2O2/c1-2-8-19-13-9-10(17)6-7-12(13)18-16(19)11-4-3-5-14(20)15(11)21/h3-7,9,20-21H,2,8H2,1H3 |
| InChIKey | CKKFXYUHJHPDCM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|