C11H12FN5O2 — CID 136928843
4-[3-fluoro-2-[(propan-2-ylideneamino)oxymethyl]phenyl]-1H-tetrazol-5-one (PubChem CID 136928843) has the molecular formula C11H12FN5O2 and a molecular weight of 265.25 g/mol. Its IUPAC name is 4-[3-fluoro-2-[(propan-2-ylideneamino)oxymethyl]phenyl]-1H-tetrazol-5-one.
| Compound Name | 4-[3-fluoro-2-[(propan-2-ylideneamino)oxymethyl]phenyl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 136928843 |
| Molecular Formula | C11H12FN5O2 |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[3-fluoro-2-[(propan-2-ylideneamino)oxymethyl]phenyl]-1H-tetrazol-5-one |
| SMILES | CC(C)=NOCc1c(F)cccc1-n1nn[nH]c1=O |
| InChI | InChI=1S/C11H12FN5O2/c1-7(2)14-19-6-8-9(12)4-3-5-10(8)17-11(18)13-15-16-17/h3-5H,6H2,1-2H3,(H,13,16,18) |
| InChIKey | GAVHWCIPUCFRJK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|