About N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide
N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide (PubChem CID 136928887) has the molecular formula C15H19N3O4
and a molecular weight of 305.33 g/mol. Its IUPAC name is N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide |
| PubChem CID | 136928887 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide |
| SMILES | CCn1nc(C(=O)NC(C)(C)C)c(=O)c2cc(O)c(O)cc21 |
| InChI | InChI=1S/C15H19N3O4/c1-5-18-9-7-11(20)10(19)6-8(9)13(21)12(17-18)14(22)16-15(2,3)4/h6-7,19-20H,5H2,1-4H3,(H,16,22) |
| InChIKey | YYOSSQJIYCEJKQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide?
The IUPAC name of N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide (CID 136928887) is N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide.
What is the SMILES notation for N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide?
The canonical SMILES for N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide is CCn1nc(C(=O)NC(C)(C)C)c(=O)c2cc(O)c(O)cc21.
What is the InChIKey of N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide?
The InChIKey is YYOSSQJIYCEJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4/c1-5-18-9-7-11(20)10(19)6-8(9)13(21)12(17-18)14(22)16-15(2,3)4/h6-7,19-20H,5H2,1-4H3,(H,16,22).
What are the key properties of N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide?
N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide has a molecular weight of 305.33 g/mol, XLogP of 1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-ethyl-6,7-dihydroxy-4-oxocinnoline-3-carboxamide is sourced from PubChem (CID 136928887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).