C18H25N5O2 — CID 136928971
ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)amino]benzoate (PubChem CID 136928971) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)amino]benzoate.
| Compound Name | ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 136928971 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC2=NC3(CCCCC3)N/C(=N/C)N2)c1 |
| InChI | InChI=1S/C18H25N5O2/c1-3-25-15(24)13-8-7-9-14(12-13)20-17-21-16(19-2)22-18(23-17)10-5-4-6-11-18/h7-9,12H,3-6,10-11H2,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | HEOXYJVVVNWPBB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|