About 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole
2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole (PubChem CID 136929557) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole |
| PubChem CID | 136929557 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole |
| SMILES | COc1cc(-c2cccc3[nH]c(-c4n[nH]c5ccccc45)nc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N4O3/c1-28-18-11-13(12-19(29-2)22(18)30-3)14-8-6-10-17-20(14)25-23(24-17)21-15-7-4-5-9-16(15)26-27-21/h4-12H,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | FJJCHCTWDZRIEA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
The IUPAC name of 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole (CID 136929557) is 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole.
What is the SMILES notation for 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
The canonical SMILES for 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole is COc1cc(-c2cccc3[nH]c(-c4n[nH]c5ccccc45)nc23)cc(OC)c1OC.
What is the InChIKey of 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
The InChIKey is FJJCHCTWDZRIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c1-28-18-11-13(12-19(29-2)22(18)30-3)14-8-6-10-17-20(14)25-23(24-17)21-15-7-4-5-9-16(15)26-27-21/h4-12H,1-3H3,(H,24,25)(H,26,27).
What are the key properties of 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole has a molecular weight of 400.44 g/mol, XLogP of 4.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indazol-3-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole is sourced from PubChem (CID 136929557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).