About 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole
2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole (PubChem CID 136929684) has the molecular formula C17H11FN4O2
and a molecular weight of 322.30 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole |
| PubChem CID | 136929684 |
| Molecular Formula | C17H11FN4O2 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole |
| SMILES | Fc1ccc2nc(-c3cc(-c4ccc5c(c4)OCO5)n[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C17H11FN4O2/c18-10-2-3-11-13(6-10)20-17(19-11)14-7-12(21-22-14)9-1-4-15-16(5-9)24-8-23-15/h1-7H,8H2,(H,19,20)(H,21,22) |
| InChIKey | JFESWRVPKVDRET-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole?
The IUPAC name of 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole (CID 136929684) is 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole.
What is the SMILES notation for 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole?
The canonical SMILES for 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole is Fc1ccc2nc(-c3cc(-c4ccc5c(c4)OCO5)n[nH]3)[nH]c2c1.
What is the InChIKey of 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole?
The InChIKey is JFESWRVPKVDRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN4O2/c18-10-2-3-11-13(6-10)20-17(19-11)14-7-12(21-22-14)9-1-4-15-16(5-9)24-8-23-15/h1-7H,8H2,(H,19,20)(H,21,22).
What are the key properties of 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole?
2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole has a molecular weight of 322.30 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-6-fluoro-1H-benzimidazole is sourced from PubChem (CID 136929684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).